C24H33N5O2 — CID 118900052
2-butoxy-7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 118900052) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-butoxy-7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-butoxy-7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118900052 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-butoxy-7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCOc1nc(N)c2[nH]cc(Cc3ccc(CN4CC(C)OC(C)C4)cc3)c2n1 |
| InChI | InChI=1S/C24H33N5O2/c1-4-5-10-30-24-27-21-20(12-26-22(21)23(25)28-24)11-18-6-8-19(9-7-18)15-29-13-16(2)31-17(3)14-29/h6-9,12,16-17,26H,4-5,10-11,13-15H2,1-3H3,(H2,25,27,28) |
| InChIKey | ZKDISCNTUQYZSD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|