C24H31N5O2 — CID 146846020
2-butoxy-7-[[4-(7-oxa-4-azaspiro[2.5]octan-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 146846020) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-butoxy-7-[[4-(7-oxa-4-azaspiro[2.5]octan-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-butoxy-7-[[4-(7-oxa-4-azaspiro[2.5]octan-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146846020 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-butoxy-7-[[4-(7-oxa-4-azaspiro[2.5]octan-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCOc1nc(N)c2[nH]cc(Cc3ccc(CN4CCOCC45CC5)cc3)c2n1 |
| InChI | InChI=1S/C24H31N5O2/c1-2-3-11-31-23-27-20-19(14-26-21(20)22(25)28-23)13-17-4-6-18(7-5-17)15-29-10-12-30-16-24(29)8-9-24/h4-7,14,26H,2-3,8-13,15-16H2,1H3,(H2,25,27,28) |
| InChIKey | SHBYZKYOWATYKF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|