C23H34N4 — CID 167157088
6-methyl-3-pentyl-5-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyridin-2-amine (PubChem CID 167157088) has the molecular formula C23H34N4 and a molecular weight of 366.55 g/mol. Its IUPAC name is 6-methyl-3-pentyl-5-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyridin-2-amine.
| Compound Name | 6-methyl-3-pentyl-5-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 167157088 |
| Molecular Formula | C23H34N4 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 6-methyl-3-pentyl-5-[[4-(piperazin-1-ylmethyl)phenyl]methyl]pyridin-2-amine |
| SMILES | CCCCCc1cc(Cc2ccc(CN3CCNCC3)cc2)c(C)nc1N |
| InChI | InChI=1S/C23H34N4/c1-3-4-5-6-21-16-22(18(2)26-23(21)24)15-19-7-9-20(10-8-19)17-27-13-11-25-12-14-27/h7-10,16,25H,3-6,11-15,17H2,1-2H3,(H2,24,26) |
| InChIKey | AOSOCYRFNSRSKF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|