C27H39N3 — CID 167157045
6-methyl-5-[[2-(2-methylprop-2-enyl)-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-pentylpyridin-2-amine (PubChem CID 167157045) has the molecular formula C27H39N3 and a molecular weight of 405.63 g/mol. Its IUPAC name is 6-methyl-5-[[2-(2-methylprop-2-enyl)-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-pentylpyridin-2-amine.
| Compound Name | 6-methyl-5-[[2-(2-methylprop-2-enyl)-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-pentylpyridin-2-amine |
|---|---|
| PubChem CID | 167157045 |
| Molecular Formula | C27H39N3 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 6-methyl-5-[[2-(2-methylprop-2-enyl)-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-pentylpyridin-2-amine |
| SMILES | C=C(C)Cc1cc(CN2CCCC2)ccc1Cc1cc(CCCCC)c(N)nc1C |
| InChI | InChI=1S/C27H39N3/c1-5-6-7-10-24-18-25(21(4)29-27(24)28)17-23-12-11-22(16-26(23)15-20(2)3)19-30-13-8-9-14-30/h11-12,16,18H,2,5-10,13-15,17,19H2,1,3-4H3,(H2,28,29) |
| InChIKey | PIDXJEBJALGKIK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|