C21H30N2 — CID 167157109
5-[2-(4-ethylphenyl)ethyl]-6-methyl-3-pentylpyridin-2-amine (PubChem CID 167157109) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 5-[2-(4-ethylphenyl)ethyl]-6-methyl-3-pentylpyridin-2-amine.
| Compound Name | 5-[2-(4-ethylphenyl)ethyl]-6-methyl-3-pentylpyridin-2-amine |
|---|---|
| PubChem CID | 167157109 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 5-[2-(4-ethylphenyl)ethyl]-6-methyl-3-pentylpyridin-2-amine |
| SMILES | CCCCCc1cc(CCc2ccc(CC)cc2)c(C)nc1N |
| InChI | InChI=1S/C21H30N2/c1-4-6-7-8-20-15-19(16(3)23-21(20)22)14-13-18-11-9-17(5-2)10-12-18/h9-12,15H,4-8,13-14H2,1-3H3,(H2,22,23) |
| InChIKey | CTWLSCFMYNJKJX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|