C22H31N3 — CID 167157124
5-[[4-[1-(dimethylamino)ethenyl]phenyl]methyl]-6-methyl-3-pentylpyridin-2-amine (PubChem CID 167157124) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is 5-[[4-[1-(dimethylamino)ethenyl]phenyl]methyl]-6-methyl-3-pentylpyridin-2-amine.
| Compound Name | 5-[[4-[1-(dimethylamino)ethenyl]phenyl]methyl]-6-methyl-3-pentylpyridin-2-amine |
|---|---|
| PubChem CID | 167157124 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 5-[[4-[1-(dimethylamino)ethenyl]phenyl]methyl]-6-methyl-3-pentylpyridin-2-amine |
| SMILES | C=C(c1ccc(Cc2cc(CCCCC)c(N)nc2C)cc1)N(C)C |
| InChI | InChI=1S/C22H31N3/c1-6-7-8-9-20-15-21(16(2)24-22(20)23)14-18-10-12-19(13-11-18)17(3)25(4)5/h10-13,15H,3,6-9,14H2,1-2,4-5H3,(H2,23,24) |
| InChIKey | NFCWUVVCVLUHCX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|