C24H29N3 — CID 167157153
6-[(4-but-1-en-2-ylphenyl)methyl]-3-pentyl-1,5-naphthyridin-2-amine (PubChem CID 167157153) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is 6-[(4-but-1-en-2-ylphenyl)methyl]-3-pentyl-1,5-naphthyridin-2-amine.
| Compound Name | 6-[(4-but-1-en-2-ylphenyl)methyl]-3-pentyl-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 167157153 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 6-[(4-but-1-en-2-ylphenyl)methyl]-3-pentyl-1,5-naphthyridin-2-amine |
| SMILES | C=C(CC)c1ccc(Cc2ccc3nc(N)c(CCCCC)cc3n2)cc1 |
| InChI | InChI=1S/C24H29N3/c1-4-6-7-8-20-16-23-22(27-24(20)25)14-13-21(26-23)15-18-9-11-19(12-10-18)17(3)5-2/h9-14,16H,3-8,15H2,1-2H3,(H2,25,27) |
| InChIKey | XGNCIJMFFNVLCY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|