C21H32N8O — CID 155053760
2-butoxy-7-[[5-methyl-6-[(2R)-2-methylpiperazin-1-yl]-2,3-dihydropyridin-3-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155053760) has the molecular formula C21H32N8O and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-butoxy-7-[[5-methyl-6-[(2R)-2-methylpiperazin-1-yl]-2,3-dihydropyridin-3-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-butoxy-7-[[5-methyl-6-[(2R)-2-methylpiperazin-1-yl]-2,3-dihydropyridin-3-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155053760 |
| Molecular Formula | C21H32N8O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 2-butoxy-7-[[5-methyl-6-[(2R)-2-methylpiperazin-1-yl]-2,3-dihydropyridin-3-yl]methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N)c2ncc(CC3C=C(C)C(N4CCNC[C@H]4C)=NC3)n2n1 |
| InChI | InChI=1S/C21H32N8O/c1-4-5-8-30-21-26-18(22)20-25-13-17(29(20)27-21)10-16-9-14(2)19(24-12-16)28-7-6-23-11-15(28)3/h9,13,15-16,23H,4-8,10-12H2,1-3H3,(H2,22,26,27)/t15-,16?/m1/s1 |
| InChIKey | FFQKOFMJFUEPDK-AAFJCEBUSA-N |
| XLogP | 1.70 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|