C45H28N6O — CID 168765452
4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-(1,7-naphthyridin-6-yl)phenyl]aniline (PubChem CID 168765452) has the molecular formula C45H28N6O and a molecular weight of 668.76 g/mol. Its IUPAC name is 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-(1,7-naphthyridin-6-yl)phenyl]aniline.
| Compound Name | 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-(1,7-naphthyridin-6-yl)phenyl]aniline |
|---|---|
| PubChem CID | 168765452 |
| Molecular Formula | C45H28N6O |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-(1,7-naphthyridin-6-yl)phenyl]aniline |
| SMILES | c1cnc2cnc(-c3ccc(N(c4ccc(-c5cc6cccnc6cn5)cc4)c4ccc(-c5ccc6c(n5)oc5ccccc56)cc4)cc3)cc2c1 |
| InChI | InChI=1S/C45H28N6O/c1-2-8-44-37(7-1)38-21-22-39(50-45(38)52-44)29-9-15-34(16-10-29)51(35-17-11-30(12-18-35)40-25-32-5-3-23-46-42(32)27-48-40)36-19-13-31(14-20-36)41-26-33-6-4-24-47-43(33)28-49-41/h1-28H |
| InChIKey | XGJNKGHDYPTUHW-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 80.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |