C51H30N4O3 — CID 168765645
4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-([1]benzofuro[2,3-b]pyridin-2-yl)phenyl]aniline (PubChem CID 168765645) has the molecular formula C51H30N4O3 and a molecular weight of 746.83 g/mol. Its IUPAC name is 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-([1]benzofuro[2,3-b]pyridin-2-yl)phenyl]aniline.
| Compound Name | 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-([1]benzofuro[2,3-b]pyridin-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 168765645 |
| Molecular Formula | C51H30N4O3 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 746.23 |
| IUPAC Name | 4-([1]benzofuro[2,3-b]pyridin-2-yl)-N,N-bis[4-([1]benzofuro[2,3-b]pyridin-2-yl)phenyl]aniline |
| SMILES | c1ccc2c(c1)oc1nc(-c3ccc(N(c4ccc(-c5ccc6c(n5)oc5ccccc56)cc4)c4ccc(-c5ccc6c(n5)oc5ccccc56)cc4)cc3)ccc12 |
| InChI | InChI=1S/C51H30N4O3/c1-4-10-46-37(7-1)40-25-28-43(52-49(40)56-46)31-13-19-34(20-14-31)55(35-21-15-32(16-22-35)44-29-26-41-38-8-2-5-11-47(38)57-50(41)53-44)36-23-17-33(18-24-36)45-30-27-42-39-9-3-6-12-48(39)58-51(42)54-45/h1-30H |
| InChIKey | LZSWDQCRULTSGG-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 81.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |