C42H25N5O3 — CID 168765489
N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)aniline (PubChem CID 168765489) has the molecular formula C42H25N5O3 and a molecular weight of 647.69 g/mol. Its IUPAC name is N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)aniline.
| Compound Name | N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)aniline |
|---|---|
| PubChem CID | 168765489 |
| Molecular Formula | C42H25N5O3 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)aniline |
| SMILES | c1ccc2oc(-c3ccc(N(c4ccc(-c5cnc6c(c5)oc5ncccc56)cc4)c4ccc(-c5nc6ccccc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C42H25N5O3/c1-3-9-36-34(7-1)45-40(48-36)27-13-19-31(20-14-27)47(32-21-15-28(16-22-32)41-46-35-8-2-4-10-37(35)49-41)30-17-11-26(12-18-30)29-24-38-39(44-25-29)33-6-5-23-43-42(33)50-38/h1-25H |
| InChIKey | DSBJPOMHNRNVJQ-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 94.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |