C42H25N5O2S — CID 168765708
4-([1]benzothiolo[3,2-d]pyrimidin-7-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]aniline (PubChem CID 168765708) has the molecular formula C42H25N5O2S and a molecular weight of 663.76 g/mol. Its IUPAC name is 4-([1]benzothiolo[3,2-d]pyrimidin-7-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]aniline.
| Compound Name | 4-([1]benzothiolo[3,2-d]pyrimidin-7-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 168765708 |
| Molecular Formula | C42H25N5O2S |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | 4-([1]benzothiolo[3,2-d]pyrimidin-7-yl)-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]aniline |
| SMILES | c1ccc2oc(-c3ccc(N(c4ccc(-c5ccc6c(c5)sc5cncnc56)cc4)c4ccc(-c5nc6ccccc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C42H25N5O2S/c1-3-7-36-34(5-1)45-41(48-36)27-11-18-31(19-12-27)47(32-20-13-28(14-21-32)42-46-35-6-2-4-8-37(35)49-42)30-16-9-26(10-17-30)29-15-22-33-38(23-29)50-39-24-43-25-44-40(33)39/h1-25H |
| InChIKey | RDNLTBQUQDUVID-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |