C19H13N3O5 — CID 16876901
N-(2-benzoylphenyl)-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide (PubChem CID 16876901) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide.
| Compound Name | N-(2-benzoylphenyl)-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide |
|---|---|
| PubChem CID | 16876901 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(2-benzoylphenyl)-2-(2,4,6-trioxo-1,3-diazinan-5-ylidene)acetamide |
| SMILES | O=C(C=C1C(=O)NC(=O)NC1=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H13N3O5/c23-15(10-13-17(25)21-19(27)22-18(13)26)20-14-9-5-4-8-12(14)16(24)11-6-2-1-3-7-11/h1-10H,(H,20,23)(H2,21,22,25,26,27) |
| InChIKey | OJZGSPDJAMSYLE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|