C51H33N5 — CID 168769940
11-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-2,4,8,10-tetradeuterio-5-phenylindolo[3,2-b]carbazole (PubChem CID 168769940) has the molecular formula C51H33N5 and a molecular weight of 719.88 g/mol. Its IUPAC name is 11-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-2,4,8,10-tetradeuterio-5-phenylindolo[3,2-b]carbazole.
| Compound Name | 11-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-2,4,8,10-tetradeuterio-5-phenylindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 168769940 |
| Molecular Formula | C51H33N5 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | 11-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-2,4,8,10-tetradeuterio-5-phenylindolo[3,2-b]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1)c1cc3c(cc1n2-c1ccccc1)c1cc([2H])cc([2H])c1n3-c1nc(-c2cccc(-c3ccccc3)c2)nc(-c2cccc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C51H33N5/c1-4-16-34(17-5-1)36-20-14-22-38(30-36)49-52-50(39-23-15-21-37(31-39)35-18-6-2-7-19-35)54-51(53-49)56-46-29-13-11-27-42(46)44-32-47-43(33-48(44)56)41-26-10-12-28-45(41)55(47)40-24-8-3-9-25-40/h1-33H/i10D,11D,28D,29D |
| InChIKey | GIRVFBJASWGEGV-RNCJBKRGSA-N |
| XLogP | 12.73 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |