C39H25N5 — CID 164847643
2,4,6,8,10,12-hexadeuterio-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylindolo[2,3-b]carbazole (PubChem CID 164847643) has the molecular formula C39H25N5 and a molecular weight of 569.70 g/mol. Its IUPAC name is 2,4,6,8,10,12-hexadeuterio-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylindolo[2,3-b]carbazole.
| Compound Name | 2,4,6,8,10,12-hexadeuterio-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 164847643 |
| Molecular Formula | C39H25N5 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2,4,6,8,10,12-hexadeuterio-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylindolo[2,3-b]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1)c1c([2H])c3c4cc([2H])cc([2H])c4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c([2H])c1n2-c1ccccc1 |
| InChI | InChI=1S/C39H25N5/c1-4-14-26(15-5-1)37-40-38(27-16-6-2-7-17-27)42-39(41-37)44-34-23-13-11-21-30(34)32-24-31-29-20-10-12-22-33(29)43(35(31)25-36(32)44)28-18-8-3-9-19-28/h1-25H/i10D,11D,22D,23D,24D,25D |
| InChIKey | BCGULYJGWKTPKY-QBGMVVKMSA-N |
| XLogP | 9.40 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |