C51H33N5 — CID 164847703
2,4,6,9,11-pentadeuterio-5-(3,5-diphenylphenyl)-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole (PubChem CID 164847703) has the molecular formula C51H33N5 and a molecular weight of 720.89 g/mol. Its IUPAC name is 2,4,6,9,11-pentadeuterio-5-(3,5-diphenylphenyl)-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole.
| Compound Name | 2,4,6,9,11-pentadeuterio-5-(3,5-diphenylphenyl)-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 164847703 |
| Molecular Formula | C51H33N5 |
| Molecular Weight | 720.89 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | 2,4,6,9,11-pentadeuterio-5-(3,5-diphenylphenyl)-12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[3,2-c]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1)c1c(c([2H])cc3c4cc([2H])cc([2H])c4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c31)n2-c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C51H33N5/c1-5-17-34(18-6-1)38-31-39(35-19-7-2-8-20-35)33-40(32-38)55-45-28-16-14-26-43(45)47-46(55)30-29-42-41-25-13-15-27-44(41)56(48(42)47)51-53-49(36-21-9-3-10-22-36)52-50(54-51)37-23-11-4-12-24-37/h1-33H/i13D,14D,27D,28D,30D |
| InChIKey | QQYASMOCSCUUBY-HRWKSZIXSA-N |
| XLogP | 12.73 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.89 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |