C39H23N3O2 — CID 168770429
2,4-diphenyl-6-[9-(2,4,6,8-tetradeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-1,3,5-triazine (PubChem CID 168770429) has the molecular formula C39H23N3O2 and a molecular weight of 569.66 g/mol. Its IUPAC name is 2,4-diphenyl-6-[9-(2,4,6,8-tetradeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[9-(2,4,6,8-tetradeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168770429 |
| Molecular Formula | C39H23N3O2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2,4-diphenyl-6-[9-(2,4,6,8-tetradeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-1,3,5-triazine |
| SMILES | [2H]c1cc([2H])c2oc3c([2H])cc([2H])c(-c4cccc5oc6cc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)ccc6c45)c3c2c1 |
| InChI | InChI=1S/C39H23N3O2/c1-3-11-24(12-4-1)37-40-38(25-13-5-2-6-14-25)42-39(41-37)26-21-22-30-34(23-26)44-33-20-10-17-28(36(30)33)27-16-9-19-32-35(27)29-15-7-8-18-31(29)43-32/h1-23H/i7D,16D,18D,19D |
| InChIKey | GOKZGCFUHSIANE-SXWDYEMUSA-N |
| XLogP | 10.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |