C43H25N3O2 — CID 170941859
2-[5-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)naphthalen-1-yl]-4-(2,4,6,7,8-pentadeuteriodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine (PubChem CID 170941859) has the molecular formula C43H25N3O2 and a molecular weight of 627.77 g/mol. Its IUPAC name is 2-[5-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)naphthalen-1-yl]-4-(2,4,6,7,8-pentadeuteriodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[5-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)naphthalen-1-yl]-4-(2,4,6,7,8-pentadeuteriodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170941859 |
| Molecular Formula | C43H25N3O2 |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 2-[5-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)naphthalen-1-yl]-4-(2,4,6,7,8-pentadeuteriodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1cc2c(oc3c([2H])cc([2H])c(-c4nc(-c5ccccc5)nc(-c5cccc6c(-c7c([2H])c([2H])c([2H])c8oc9c([2H])c([2H])c([2H])c([2H])c9c78)cccc56)n4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C43H25N3O2/c1-2-12-26(13-3-1)41-44-42(46-43(45-41)34-21-11-25-38-40(34)33-15-5-7-23-36(33)48-38)31-20-9-16-27-28(17-8-18-29(27)31)30-19-10-24-37-39(30)32-14-4-6-22-35(32)47-37/h1-25H/i4D,5D,6D,7D,10D,14D,19D,21D,22D,23D,24D,25D |
| InChIKey | BTEDSQRVVQSZNO-SZVIIRCGSA-N |
| XLogP | 11.49 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |