C37H23N3O — CID 168731866
2-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-4-(2,3,4,6,7,8-hexadeuterio-5-phenylnaphthalen-1-yl)-6-phenyl-1,3,5-triazine (PubChem CID 168731866) has the molecular formula C37H23N3O and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-4-(2,3,4,6,7,8-hexadeuterio-5-phenylnaphthalen-1-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-4-(2,3,4,6,7,8-hexadeuterio-5-phenylnaphthalen-1-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168731866 |
| Molecular Formula | C37H23N3O |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-4-(2,3,4,6,7,8-hexadeuterio-5-phenylnaphthalen-1-yl)-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(-c4nc(-c5ccccc5)nc(-c5c([2H])c([2H])c([2H])c6c(-c7ccccc7)c([2H])c([2H])c([2H])c56)n4)c32)c1[2H] |
| InChI | InChI=1S/C37H23N3O/c1-3-12-24(13-4-1)26-17-9-19-28-27(26)18-10-20-29(28)36-38-35(25-14-5-2-6-15-25)39-37(40-36)31-21-11-23-33-34(31)30-16-7-8-22-32(30)41-33/h1-23H/i7D,8D,9D,10D,11D,16D,17D,18D,19D,20D,21D,22D,23D |
| InChIKey | KGXGQKYFSLUXPO-AZIVPYAPSA-N |
| XLogP | 9.59 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |