C15H15N3O2 — CID 168770755
2-[1-methyl-3-[(2R)-oxolan-2-yl]pyrazol-5-yl]oxybenzonitrile (PubChem CID 168770755) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[1-methyl-3-[(2R)-oxolan-2-yl]pyrazol-5-yl]oxybenzonitrile.
| Compound Name | 2-[1-methyl-3-[(2R)-oxolan-2-yl]pyrazol-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 168770755 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[1-methyl-3-[(2R)-oxolan-2-yl]pyrazol-5-yl]oxybenzonitrile |
| SMILES | Cn1nc([C@H]2CCCO2)cc1Oc1ccccc1C#N |
| InChI | InChI=1S/C15H15N3O2/c1-18-15(9-12(17-18)14-7-4-8-19-14)20-13-6-3-2-5-11(13)10-16/h2-3,5-6,9,14H,4,7-8H2,1H3/t14-/m1/s1 |
| InChIKey | CZXYVAKIXCWZKG-CQSZACIVSA-N |
| XLogP | 2.94 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |