C15H6ClF3O2S — CID 168780900
6-chloro-3-(2,4,5-trifluorophenyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 168780900) has the molecular formula C15H6ClF3O2S and a molecular weight of 342.73 g/mol. Its IUPAC name is 6-chloro-3-(2,4,5-trifluorophenyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-chloro-3-(2,4,5-trifluorophenyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 168780900 |
| Molecular Formula | C15H6ClF3O2S |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 6-chloro-3-(2,4,5-trifluorophenyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cc(Cl)ccc2c1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H6ClF3O2S/c16-6-1-2-7-12(3-6)22-14(15(20)21)13(7)8-4-10(18)11(19)5-9(8)17/h1-5H,(H,20,21) |
| InChIKey | OVNVTGJROIKSDO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|