About CID 168782278
CID 168782278 (PubChem CID 168782278) has the molecular formula C58H40N4OPt-2
and a molecular weight of 1009.09 g/mol.
Molecular Properties
| Compound Name | CID 168782278 |
| PubChem CID | 168782278 |
| Molecular Formula | C58H40N4OPt-2 |
| Molecular Weight | 1009.09 g/mol |
| Exact Mass | 1008.32 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2ccccc2-[n+]2[c-]n(-c4[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc4)c4cccc(c42)-c2ccccc2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C58H40N4O.Pt/c1-58(2,3)39-32-33-59-55(34-39)62-52-28-12-9-22-46(52)47-31-30-42(36-54(47)62)63-41-19-13-18-40(35-41)60-37-61-51-27-11-10-23-50(51)56-43(38-16-5-4-6-17-38)24-14-25-48(56)44-20-7-8-21-45(44)49-26-15-29-53(60)57(49)61;/h4-34H,1-3H3;/q-2;/i4D,5D,6D,16D,17D; |
| InChIKey | NIKTYIQZFZFDQR-YBHQIQAZSA-N |
| XLogP | 13.87 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1009.09 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 168782278 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168782278?
The IUPAC name of CID 168782278 (CID 168782278) is not available.
What is the SMILES notation for CID 168782278?
The canonical SMILES for CID 168782278 is [2H]c1c([2H])c([2H])c(-c2cccc3c2-c2ccccc2-[n+]2[c-]n(-c4[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc4)c4cccc(c42)-c2ccccc2-3)c([2H])c1[2H].[Pt].
What is the InChIKey of CID 168782278?
The InChIKey is NIKTYIQZFZFDQR-YBHQIQAZSA-N. The full InChI is InChI=1S/C58H40N4O.Pt/c1-58(2,3)39-32-33-59-55(34-39)62-52-28-12-9-22-46(52)47-31-30-42(36-54(47)62)63-41-19-13-18-40(35-41)60-37-61-51-27-11-10-23-50(51)56-43(38-16-5-4-6-17-38)24-14-25-48(56)44-20-7-8-21-45(44)49-26-15-29-53(60)57(49)61;/h4-34H,1-3H3;/q-2;/i4D,5D,6D,16D,17D;.
What are the key properties of CID 168782278?
CID 168782278 has a molecular weight of 1009.09 g/mol, XLogP of 13.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168782278 is sourced from PubChem (CID 168782278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).