C62H48N4OPt-2 — CID 171046530
CID 171046530 (PubChem CID 171046530) has the molecular formula C62H48N4OPt-2 and a molecular weight of 1065.20 g/mol.
| Compound Name | CID 171046530 |
|---|---|
| PubChem CID | 171046530 |
| Molecular Formula | C62H48N4OPt-2 |
| Molecular Weight | 1065.20 g/mol |
| Exact Mass | 1064.38 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)-c2cccc(C(C)(C)C)c2-[n+]2[c-]n(-c4[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc4)c4cccc(c42)-c2ccccc2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C62H48N4O.Pt/c1-61(2,3)42-33-34-63-58(36-42)66-55-27-13-12-23-49(55)50-32-30-45(38-57(50)66)67-44-20-14-19-43(37-44)64-39-65-59-52(24-15-26-54(59)62(4,5)6)53-35-41(40-17-8-7-9-18-40)29-31-48(53)46-21-10-11-22-47(46)51-25-16-28-56(64)60(51)65;/h7-36H,1-6H3;/q-2;/i7D,8D,9D,17D,18D; |
| InChIKey | HVUNKMZKDGZWNA-VKALESIYSA-N |
| XLogP | 15.17 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.20 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|