C70H64N4OPt-2 — CID 171048351
CID 171048351 (PubChem CID 171048351) has the molecular formula C70H64N4OPt-2 and a molecular weight of 1172.39 g/mol.
| Compound Name | CID 171048351 |
|---|---|
| PubChem CID | 171048351 |
| Molecular Formula | C70H64N4OPt-2 |
| Molecular Weight | 1172.39 g/mol |
| Exact Mass | 1171.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2cccc3c2-[n+]2[c-]n(-c4[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc4)c4cccc(c42)-c2ccccc2-c2ccc(C(C)(C)C)cc2-3)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C70H64N4O.Pt/c1-67(2,3)45-30-32-55-53-22-13-14-23-54(53)58-27-19-29-62-66(58)73(65-52(25-18-26-59(65)60(55)39-45)44-36-47(69(7,8)9)38-48(37-44)70(10,11)12)43-72(62)49-20-17-21-50(41-49)75-51-31-33-57-56-24-15-16-28-61(56)74(63(57)42-51)64-40-46(34-35-71-64)68(4,5)6;/h13-40H,1-12H3;/q-2; |
| InChIKey | CMSRCLLNZJZMHD-UHFFFAOYSA-N |
| XLogP | 17.76 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1172.39 |
| LogP ≤ 5 | 17.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|