About CID 164734023
CID 164734023 (PubChem CID 164734023) has the molecular formula C57H39N5OPt-2
and a molecular weight of 1005.05 g/mol.
Molecular Properties
| Compound Name | CID 164734023 |
| PubChem CID | 164734023 |
| Molecular Formula | C57H39N5OPt-2 |
| Molecular Weight | 1005.05 g/mol |
| Exact Mass | 1004.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5cncc(-c7ccccc7)c5-6)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C57H39N5O.Pt/c1-57(2,3)38-29-30-59-54(31-38)62-51-25-12-11-23-46(51)47-28-27-41(33-53(47)62)63-40-18-13-17-39(32-40)60-36-61-55-49(37-15-5-4-6-16-37)34-58-35-50(55)45-22-10-8-20-43(45)42-19-7-9-21-44(42)48-24-14-26-52(60)56(48)61;/h4-31,34-35H,1-3H3;/q-2; |
| InChIKey | PXLYUUPGOQSDOI-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1005.05 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164734023 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164734023?
The IUPAC name of CID 164734023 (CID 164734023) is not available.
What is the SMILES notation for CID 164734023?
The canonical SMILES for CID 164734023 is CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccccc5-c5cncc(-c7ccccc7)c5-6)ccc4)ccc3c3ccccc32)c1.[Pt].
What is the InChIKey of CID 164734023?
The InChIKey is PXLYUUPGOQSDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H39N5O.Pt/c1-57(2,3)38-29-30-59-54(31-38)62-51-25-12-11-23-46(51)47-28-27-41(33-53(47)62)63-40-18-13-17-39(32-40)60-36-61-55-49(37-15-5-4-6-16-37)34-58-35-50(55)45-22-10-8-20-43(45)42-19-7-9-21-44(42)48-24-14-26-52(60)56(48)61;/h4-31,34-35H,1-3H3;/q-2;.
What are the key properties of CID 164734023?
CID 164734023 has a molecular weight of 1005.05 g/mol, XLogP of 13.26, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164734023 is sourced from PubChem (CID 164734023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).