C53H49N5OPt-2 — CID 171765554
9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-4-phenyl-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-1H-carbazol-1-ide;platinum (PubChem CID 171765554) has the molecular formula C53H49N5OPt-2 and a molecular weight of 967.09 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-4-phenyl-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-4-phenyl-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 171765554 |
| Molecular Formula | C53H49N5OPt-2 |
| Molecular Weight | 967.09 g/mol |
| Exact Mass | 966.36 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-4-phenyl-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)cnc3)c3cccc(-c4ccccc4)c32)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C53H49N5O.Pt/c1-51(2,3)36-24-25-55-49(29-36)58-46-20-14-13-18-44(46)45-23-22-41(31-48(45)58)59-42-30-40(32-54-33-42)56-34-57(39-27-37(52(4,5)6)26-38(28-39)53(7,8)9)50-43(19-15-21-47(50)56)35-16-11-10-12-17-35;/h10-29,32-33H,1-9H3;/q-2; |
| InChIKey | JTTKXUHYOOJMAO-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.09 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|