C52H47N5OPt-2 — CID 171765517
2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-1H-carbazol-1-ide;platinum (PubChem CID 171765517) has the molecular formula C52H47N5OPt-2 and a molecular weight of 953.06 g/mol. Its IUPAC name is 2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 171765517 |
| Molecular Formula | C52H47N5OPt-2 |
| Molecular Weight | 953.06 g/mol |
| Exact Mass | 952.34 |
| IUPAC Name | 2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-4H-pyridin-4-id-3-yl]oxy]-9-[4-(2-phenylpropan-2-yl)-2-pyridinyl]-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)c5ccccc5)ccn4)cnc3)c3ccccc32)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C52H47N5O.Pt/c1-50(2,3)37-26-38(51(4,5)6)28-39(27-37)55-34-56(47-21-15-14-20-46(47)55)40-30-42(33-53-32-40)58-41-22-23-44-43-18-12-13-19-45(43)57(48(44)31-41)49-29-36(24-25-54-49)52(7,8)35-16-10-9-11-17-35;/h9-29,32-33H,1-8H3;/q-2; |
| InChIKey | JVRVHUDBQZUJGY-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.06 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|