C75H58N4OPt-2 — CID 169019219
CID 169019219 (PubChem CID 169019219) has the molecular formula C75H58N4OPt-2 and a molecular weight of 1228.41 g/mol.
| Compound Name | CID 169019219 |
|---|---|
| PubChem CID | 169019219 |
| Molecular Formula | C75H58N4OPt-2 |
| Molecular Weight | 1228.41 g/mol |
| Exact Mass | 1227.44 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5ccccc5-c5ccc(C(C)(C)C)cc5-c5cccc(-c7cc(-c8ccccc8)cc(-c8ccccc8)c7)c5-6)ccc4)ccc3c3ccccc32)c1)C(C)(C)C.[Pt] |
| InChI | InChI=1S/C75H58N4O.Pt/c1-74(2,3)47-49-38-39-76-71(40-49)79-68-32-16-15-28-63(68)64-37-35-58(46-70(64)79)80-57-25-17-24-56(45-57)77-48-78-72-59(54-42-52(50-20-9-7-10-21-50)41-53(43-54)51-22-11-8-12-23-51)29-18-30-66(72)67-44-55(75(4,5)6)34-36-62(67)60-26-13-14-27-61(60)65-31-19-33-69(77)73(65)78;/h7-44H,47H2,1-6H3;/q-2;/i47D2; |
| InChIKey | DVDMUPZMTUEHLH-CJIIATODSA-N |
| XLogP | 18.79 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1228.41 |
| LogP ≤ 5 | 18.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|