C76H57N5OPt-2 — CID 169019260
CID 169019260 (PubChem CID 169019260) has the molecular formula C76H57N5OPt-2 and a molecular weight of 1266.50 g/mol.
| Compound Name | CID 169019260 |
|---|---|
| PubChem CID | 169019260 |
| Molecular Formula | C76H57N5OPt-2 |
| Molecular Weight | 1266.50 g/mol |
| Exact Mass | 1265.52 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(-c3cccc4c3-[n+]3[c-]n(-c5[c-]c(Oc6[c-]c7c(cc6)c6ccccc6n7-c6cc(C([2H])([2H])C(C)(C)C)ccn6)cc(C#N)c5)c5cccc(c53)-c3ccccc3-c3ccc(C(C)(C)C)cc3-4)c([2H])c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2[2H])c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C76H57N5O.Pt/c1-75(2,3)46-49-35-36-78-72(39-49)81-69-29-16-15-25-64(69)65-34-32-58(45-71(65)81)82-59-38-50(47-77)37-57(44-59)79-48-80-73-60(55-41-53(51-19-9-7-10-20-51)40-54(42-55)52-21-11-8-12-22-52)26-17-27-67(73)68-43-56(76(4,5)6)31-33-63(68)61-23-13-14-24-62(61)66-28-18-30-70(79)74(66)80;/h7-43H,46H2,1-6H3;/q-2;/i7D,8D,9D,10D,11D,12D,19D,20D,21D,22D,40D,41D,42D,46D2; |
| InChIKey | MUROWFPTRCAUTC-YRBYVTPNSA-N |
| XLogP | 18.66 |
| TPSA | 59.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1266.50 |
| LogP ≤ 5 | 18.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|