C11H12N6O4 — CID 168782879
6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,6,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,10-tetraen-2-one (PubChem CID 168782879) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,6,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,10-tetraen-2-one.
| Compound Name | 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,6,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,10-tetraen-2-one |
|---|---|
| PubChem CID | 168782879 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,6,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,10-tetraen-2-one |
| SMILES | O=c1c2ccn([C@H]3CC(O)[C@@H](CO)O3)c2nc2nn[nH]n12 |
| InChI | InChI=1S/C11H12N6O4/c18-4-7-6(19)3-8(21-7)16-2-1-5-9(16)12-11-13-14-15-17(11)10(5)20/h1-2,6-8,18-19H,3-4H2,(H,12,13,15)/t6?,7-,8-/m1/s1 |
| InChIKey | LMUCZFDSIQCLKT-SPDVFEMOSA-N |
| XLogP | -1.59 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |