C32H40N2O7 — CID 168785833
phenyl N-[(2S)-1-[(2S,4R)-2-[3-[4-ethynyl-2-(3-methoxypropoxy)phenyl]propanoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 168785833) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is phenyl N-[(2S)-1-[(2S,4R)-2-[3-[4-ethynyl-2-(3-methoxypropoxy)phenyl]propanoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | phenyl N-[(2S)-1-[(2S,4R)-2-[3-[4-ethynyl-2-(3-methoxypropoxy)phenyl]propanoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 168785833 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | phenyl N-[(2S)-1-[(2S,4R)-2-[3-[4-ethynyl-2-(3-methoxypropoxy)phenyl]propanoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(CCC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)Oc2ccccc2)C(C)(C)C)c(OCCCOC)c1 |
| InChI | InChI=1S/C32H40N2O7/c1-6-22-13-14-23(28(19-22)40-18-10-17-39-5)15-16-27(36)26-20-24(35)21-34(26)30(37)29(32(2,3)4)33-31(38)41-25-11-8-7-9-12-25/h1,7-9,11-14,19,24,26,29,35H,10,15-18,20-21H2,2-5H3,(H,33,38)/t24-,26+,29-/m1/s1 |
| InChIKey | INADVLQDOCVKKB-DOBADDLBSA-N |
| XLogP | 3.75 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|