C30H44N6O6 — CID 168787285
2,2-bis[3-(2-ethylimidazol-1-yl)propanoyloxymethyl]butyl 3-(2-ethylimidazol-1-yl)propanoate (PubChem CID 168787285) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is 2,2-bis[3-(2-ethylimidazol-1-yl)propanoyloxymethyl]butyl 3-(2-ethylimidazol-1-yl)propanoate.
| Compound Name | 2,2-bis[3-(2-ethylimidazol-1-yl)propanoyloxymethyl]butyl 3-(2-ethylimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 168787285 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2,2-bis[3-(2-ethylimidazol-1-yl)propanoyloxymethyl]butyl 3-(2-ethylimidazol-1-yl)propanoate |
| SMILES | CCc1nccn1CCC(=O)OCC(CC)(COC(=O)CCn1ccnc1CC)COC(=O)CCn1ccnc1CC |
| InChI | InChI=1S/C30H44N6O6/c1-5-24-31-12-18-34(24)15-9-27(37)40-21-30(8-4,22-41-28(38)10-16-35-19-13-32-25(35)6-2)23-42-29(39)11-17-36-20-14-33-26(36)7-3/h12-14,18-20H,5-11,15-17,21-23H2,1-4H3 |
| InChIKey | XCMQPEFHOMQMHX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 132.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|