C16H26N2O5 — CID 170033752
[2-(formyloxymethyl)-2-(methoxymethyl)butyl] 3-(2-ethylimidazol-1-yl)propanoate (PubChem CID 170033752) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is [2-(formyloxymethyl)-2-(methoxymethyl)butyl] 3-(2-ethylimidazol-1-yl)propanoate.
| Compound Name | [2-(formyloxymethyl)-2-(methoxymethyl)butyl] 3-(2-ethylimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 170033752 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [2-(formyloxymethyl)-2-(methoxymethyl)butyl] 3-(2-ethylimidazol-1-yl)propanoate |
| SMILES | CCc1nccn1CCC(=O)OCC(CC)(COC)COC=O |
| InChI | InChI=1S/C16H26N2O5/c1-4-14-17-7-9-18(14)8-6-15(20)23-12-16(5-2,10-21-3)11-22-13-19/h7,9,13H,4-6,8,10-12H2,1-3H3 |
| InChIKey | TUENDGMTHAJCRN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|