C35H26IrN3O — CID 168787658
iridium(3+);2-(phenoxy)-6-(1-phenyl-1-pyridin-2-ylethyl)pyridine;2-phenylpyridine (PubChem CID 168787658) has the molecular formula C35H26IrN3O and a molecular weight of 696.83 g/mol. Its IUPAC name is iridium(3+);2-(phenoxy)-6-(1-phenyl-1-pyridin-2-ylethyl)pyridine;2-phenylpyridine.
| Compound Name | iridium(3+);2-(phenoxy)-6-(1-phenyl-1-pyridin-2-ylethyl)pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 168787658 |
| Molecular Formula | C35H26IrN3O |
| Molecular Weight | 696.83 g/mol |
| Exact Mass | 697.17 |
| IUPAC Name | iridium(3+);2-(phenoxy)-6-(1-phenyl-1-pyridin-2-ylethyl)pyridine;2-phenylpyridine |
| SMILES | CC(c1[c-]cccc1)(c1ccccn1)c1cccc(Oc2[c-]cccc2)n1.[Ir+3].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C24H18N2O.C11H8N.Ir/c1-24(19-11-4-2-5-12-19,21-15-8-9-18-25-21)22-16-10-17-23(26-22)27-20-13-6-3-7-14-20;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-11,13,15-18H,1H3;1-6,8-9H;/q-2;-1;+3 |
| InChIKey | FUKBRDDTVFRNAD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.83 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|