C38H28F5IrN3O2-2 — CID 58621418
2-(2,4-difluorobenzene-6-id-1-yl)-6-[4-(phenoxy)-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine;iridium;phenol (PubChem CID 58621418) has the molecular formula C38H28F5IrN3O2-2 and a molecular weight of 845.87 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)-6-[4-(phenoxy)-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine;iridium;phenol.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)-6-[4-(phenoxy)-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine;iridium;phenol |
|---|---|
| PubChem CID | 58621418 |
| Molecular Formula | C38H28F5IrN3O2-2 |
| Molecular Weight | 845.87 g/mol |
| Exact Mass | 846.17 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)-6-[4-(phenoxy)-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine;iridium;phenol |
| SMILES | Fc1c[c-]c(-c2cccc(C(CCCOc3[c-]cccc3)(c3ccccn3)c3cccc(C(F)(F)F)n3)n2)c(F)c1.Oc1ccccc1.[Ir] |
| InChI | InChI=1S/C32H22F5N3O.C6H6O.Ir/c33-22-16-17-24(25(34)21-22)26-11-6-13-28(39-26)31(27-12-4-5-19-38-27,18-8-20-41-23-9-2-1-3-10-23)29-14-7-15-30(40-29)32(35,36)37;7-6-4-2-1-3-5-6;/h1-7,9,11-16,19,21H,8,18,20H2;1-5,7H;/q-2;; |
| InChIKey | IGJRRGMLKXXXBY-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.87 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|