C39H31FIrN3O2 — CID 58621193
2-[1-(3-fluorobenzene-6-id-1-yl)-1-phenylethyl]-6-[1-(6-phenyl-2-pyridinyl)-1-(2-pyridin-2-yloxyethoxy)ethyl]pyridine;iridium(3+) (PubChem CID 58621193) has the molecular formula C39H31FIrN3O2 and a molecular weight of 784.91 g/mol. Its IUPAC name is 2-[1-(3-fluorobenzene-6-id-1-yl)-1-phenylethyl]-6-[1-(6-phenyl-2-pyridinyl)-1-(2-pyridin-2-yloxyethoxy)ethyl]pyridine;iridium(3+).
| Compound Name | 2-[1-(3-fluorobenzene-6-id-1-yl)-1-phenylethyl]-6-[1-(6-phenyl-2-pyridinyl)-1-(2-pyridin-2-yloxyethoxy)ethyl]pyridine;iridium(3+) |
|---|---|
| PubChem CID | 58621193 |
| Molecular Formula | C39H31FIrN3O2 |
| Molecular Weight | 784.91 g/mol |
| Exact Mass | 785.20 |
| IUPAC Name | 2-[1-(3-fluorobenzene-6-id-1-yl)-1-phenylethyl]-6-[1-(6-phenyl-2-pyridinyl)-1-(2-pyridin-2-yloxyethoxy)ethyl]pyridine;iridium(3+) |
| SMILES | CC(OCCOc1ccccn1)(c1cccc(-c2[c-]cccc2)n1)c1cccc(C(C)(c2[c-]cccc2)c2[c-]ccc(F)c2)n1.[Ir+3] |
| InChI | InChI=1S/C39H31FN3O2.Ir/c1-38(30-16-7-4-8-17-30,31-18-11-19-32(40)28-31)34-21-13-23-36(43-34)39(2,45-27-26-44-37-24-9-10-25-41-37)35-22-12-20-33(42-35)29-14-5-3-6-15-29;/h3-14,16,19-25,28H,26-27H2,1-2H3;/q-3;+3 |
| InChIKey | PQJKTSURXYIYMH-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.91 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|