C33H24IrN3O2- — CID 135975717
2-[6-[6-(2-hydroxyphenyl)-2-pyridinyl]-2-pyridinyl]phenol;iridium;2-phenylpyridine (PubChem CID 135975717) has the molecular formula C33H24IrN3O2- and a molecular weight of 686.79 g/mol. Its IUPAC name is 2-[6-[6-(2-hydroxyphenyl)-2-pyridinyl]-2-pyridinyl]phenol;iridium;2-phenylpyridine.
| Compound Name | 2-[6-[6-(2-hydroxyphenyl)-2-pyridinyl]-2-pyridinyl]phenol;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 135975717 |
| Molecular Formula | C33H24IrN3O2- |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | 2-[6-[6-(2-hydroxyphenyl)-2-pyridinyl]-2-pyridinyl]phenol;iridium;2-phenylpyridine |
| SMILES | Oc1ccccc1-c1cccc(-c2cccc(-c3ccccc3O)n2)n1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C22H16N2O2.C11H8N.Ir/c25-21-13-3-1-7-15(21)17-9-5-11-19(23-17)20-12-6-10-18(24-20)16-8-2-4-14-22(16)26;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-14,25-26H;1-6,8-9H;/q;-1; |
| InChIKey | LKVJWUZPWJSTOO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|