C32H18F9N2OPt- — CID 58004339
platinum;2-[[3-(6-pyridin-2-yl-2-pyridinyl)-5-[2,4,6-tris(trifluoromethyl)phenyl]benzene-2-id-1-yl]methyl]phenol (PubChem CID 58004339) has the molecular formula C32H18F9N2OPt- and a molecular weight of 812.57 g/mol. Its IUPAC name is platinum;2-[[3-(6-pyridin-2-yl-2-pyridinyl)-5-[2,4,6-tris(trifluoromethyl)phenyl]benzene-2-id-1-yl]methyl]phenol.
| Compound Name | platinum;2-[[3-(6-pyridin-2-yl-2-pyridinyl)-5-[2,4,6-tris(trifluoromethyl)phenyl]benzene-2-id-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 58004339 |
| Molecular Formula | C32H18F9N2OPt- |
| Molecular Weight | 812.57 g/mol |
| Exact Mass | 812.09 |
| IUPAC Name | platinum;2-[[3-(6-pyridin-2-yl-2-pyridinyl)-5-[2,4,6-tris(trifluoromethyl)phenyl]benzene-2-id-1-yl]methyl]phenol |
| SMILES | Oc1ccccc1Cc1[c-]c(-c2cccc(-c3ccccn3)n2)cc(-c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C32H18F9N2O.Pt/c33-30(34,35)22-16-23(31(36,37)38)29(24(17-22)32(39,40)41)21-14-18(12-19-6-1-2-10-28(19)44)13-20(15-21)25-8-5-9-27(43-25)26-7-3-4-11-42-26;/h1-11,14-17,44H,12H2;/q-1; |
| InChIKey | YTWHBTACZGLTJO-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.57 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|