C24H14F5N2OPt- — CID 58004397
2-[[6-[2,4-difluoro-5-pyridin-2-yl-3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]methyl]phenol;platinum (PubChem CID 58004397) has the molecular formula C24H14F5N2OPt- and a molecular weight of 636.46 g/mol. Its IUPAC name is 2-[[6-[2,4-difluoro-5-pyridin-2-yl-3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]methyl]phenol;platinum.
| Compound Name | 2-[[6-[2,4-difluoro-5-pyridin-2-yl-3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]methyl]phenol;platinum |
|---|---|
| PubChem CID | 58004397 |
| Molecular Formula | C24H14F5N2OPt- |
| Molecular Weight | 636.46 g/mol |
| Exact Mass | 636.07 |
| IUPAC Name | 2-[[6-[2,4-difluoro-5-pyridin-2-yl-3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]methyl]phenol;platinum |
| SMILES | Oc1ccccc1Cc1cccc(-c2[c-]c(-c3ccccn3)c(F)c(C(F)(F)F)c2F)n1.[Pt] |
| InChI | InChI=1S/C24H14F5N2O.Pt/c25-22-16(18-8-3-4-11-30-18)13-17(23(26)21(22)24(27,28)29)19-9-5-7-15(31-19)12-14-6-1-2-10-20(14)32;/h1-11,32H,12H2;/q-1; |
| InChIKey | BQIONFLJNDEFEW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|