C32H21F6N2OPt- — CID 58620926
2-[[3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-5-(6-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]methyl]phenol;platinum (PubChem CID 58620926) has the molecular formula C32H21F6N2OPt- and a molecular weight of 758.60 g/mol. Its IUPAC name is 2-[[3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-5-(6-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]methyl]phenol;platinum.
| Compound Name | 2-[[3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-5-(6-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]methyl]phenol;platinum |
|---|---|
| PubChem CID | 58620926 |
| Molecular Formula | C32H21F6N2OPt- |
| Molecular Weight | 758.60 g/mol |
| Exact Mass | 758.12 |
| IUPAC Name | 2-[[3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-5-(6-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]methyl]phenol;platinum |
| SMILES | Cc1cc(C(F)(F)F)c(-c2cc(Cc3ccccc3O)[c-]c(-c3cccc(-c4ccccn4)n3)c2)c(C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C32H21F6N2O.Pt/c1-19-13-24(31(33,34)35)30(25(14-19)32(36,37)38)23-17-20(15-21-7-2-3-11-29(21)41)16-22(18-23)26-9-6-10-28(40-26)27-8-4-5-12-39-27;/h2-14,17-18,41H,15H2,1H3;/q-1; |
| InChIKey | WQNQBVSOXYKXGA-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.60 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|