C25H13F8N2OPt- — CID 59342302
2-[[6-[6-[2,4-difluoro-3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]-2-pyridinyl]methyl]phenol;platinum (PubChem CID 59342302) has the molecular formula C25H13F8N2OPt- and a molecular weight of 704.45 g/mol. Its IUPAC name is 2-[[6-[6-[2,4-difluoro-3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]-2-pyridinyl]methyl]phenol;platinum.
| Compound Name | 2-[[6-[6-[2,4-difluoro-3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]-2-pyridinyl]methyl]phenol;platinum |
|---|---|
| PubChem CID | 59342302 |
| Molecular Formula | C25H13F8N2OPt- |
| Molecular Weight | 704.45 g/mol |
| Exact Mass | 704.06 |
| IUPAC Name | 2-[[6-[6-[2,4-difluoro-3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]-2-pyridinyl]methyl]phenol;platinum |
| SMILES | Oc1ccccc1Cc1cccc(-c2cccc(-c3[c-]c(C(F)(F)F)c(F)c(C(F)(F)F)c3F)n2)n1.[Pt] |
| InChI | InChI=1S/C25H13F8N2O.Pt/c26-22-15(12-16(24(28,29)30)23(27)21(22)25(31,32)33)17-7-4-9-19(35-17)18-8-3-6-14(34-18)11-13-5-1-2-10-20(13)36;/h1-10,36H,11H2;/q-1; |
| InChIKey | JAGJYEZGILODRH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|