C32H24F5N3O — CID 58621419
2-(2,4-difluorophenyl)-6-[4-phenoxy-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine (PubChem CID 58621419) has the molecular formula C32H24F5N3O and a molecular weight of 561.55 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-[4-phenoxy-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-6-[4-phenoxy-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine |
|---|---|
| PubChem CID | 58621419 |
| Molecular Formula | C32H24F5N3O |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-[4-phenoxy-1-pyridin-2-yl-1-[6-(trifluoromethyl)-2-pyridinyl]butyl]pyridine |
| SMILES | Fc1ccc(-c2cccc(C(CCCOc3ccccc3)(c3ccccn3)c3cccc(C(F)(F)F)n3)n2)c(F)c1 |
| InChI | InChI=1S/C32H24F5N3O/c33-22-16-17-24(25(34)21-22)26-11-6-13-28(39-26)31(27-12-4-5-19-38-27,18-8-20-41-23-9-2-1-3-10-23)29-14-7-15-30(40-29)32(35,36)37/h1-7,9-17,19,21H,8,18,20H2 |
| InChIKey | VUUADNLJLFYHJM-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|