C55H36N2S — CID 168791648
3-N-dibenzothiophen-3-yl-3-N'-(2,3,4,5,6-pentadeuteriophenyl)-3-N,3-N'-diphenyl-9,9'-spirobi[fluorene]-3,3'-diamine (PubChem CID 168791648) has the molecular formula C55H36N2S and a molecular weight of 762.00 g/mol. Its IUPAC name is 3-N-dibenzothiophen-3-yl-3-N'-(2,3,4,5,6-pentadeuteriophenyl)-3-N,3-N'-diphenyl-9,9'-spirobi[fluorene]-3,3'-diamine.
| Compound Name | 3-N-dibenzothiophen-3-yl-3-N'-(2,3,4,5,6-pentadeuteriophenyl)-3-N,3-N'-diphenyl-9,9'-spirobi[fluorene]-3,3'-diamine |
|---|---|
| PubChem CID | 168791648 |
| Molecular Formula | C55H36N2S |
| Molecular Weight | 762.00 g/mol |
| Exact Mass | 761.29 |
| IUPAC Name | 3-N-dibenzothiophen-3-yl-3-N'-(2,3,4,5,6-pentadeuteriophenyl)-3-N,3-N'-diphenyl-9,9'-spirobi[fluorene]-3,3'-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc3c(c2)-c2ccccc2C32c3ccccc3-c3cc(N(c4ccccc4)c4ccc5c(c4)sc4ccccc45)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C55H36N2S/c1-4-16-37(17-5-1)56(38-18-6-2-7-19-38)40-29-32-51-47(34-40)43-22-10-13-25-49(43)55(51)50-26-14-11-23-44(50)48-35-41(30-33-52(48)55)57(39-20-8-3-9-21-39)42-28-31-46-45-24-12-15-27-53(45)58-54(46)36-42/h1-36H/i1D,4D,5D,16D,17D |
| InChIKey | YBUFMUVVBMVRJM-FBTAHHKZSA-N |
| XLogP | 15.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.00 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |