C43H29NS — CID 156687450
9-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenylfluoren-3-amine (PubChem CID 156687450) has the molecular formula C43H29NS and a molecular weight of 596.81 g/mol. Its IUPAC name is 9-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenylfluoren-3-amine.
| Compound Name | 9-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenylfluoren-3-amine |
|---|---|
| PubChem CID | 156687450 |
| Molecular Formula | C43H29NS |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 9-dibenzothiophen-3-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-N,N-diphenylfluoren-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc4c(c3)sc3ccccc34)c3ccccc3-c3cc(N(c4ccccc4)c4ccccc4)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C43H29NS/c1-4-14-30(15-5-1)43(31-24-26-37-36-21-11-13-23-41(36)45-42(37)28-31)39-22-12-10-20-35(39)38-29-34(25-27-40(38)43)44(32-16-6-2-7-17-32)33-18-8-3-9-19-33/h1-29H/i1D,4D,5D,14D,15D |
| InChIKey | NWUDRHQHUYGXLO-KMIUACPRSA-N |
| XLogP | 11.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |