C59H40N2S — CID 156687603
9-dibenzothiophen-2-yl-3-N-naphthalen-1-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenylfluorene-3,6-diamine (PubChem CID 156687603) has the molecular formula C59H40N2S and a molecular weight of 814.08 g/mol. Its IUPAC name is 9-dibenzothiophen-2-yl-3-N-naphthalen-1-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenylfluorene-3,6-diamine.
| Compound Name | 9-dibenzothiophen-2-yl-3-N-naphthalen-1-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenylfluorene-3,6-diamine |
|---|---|
| PubChem CID | 156687603 |
| Molecular Formula | C59H40N2S |
| Molecular Weight | 814.08 g/mol |
| Exact Mass | 813.32 |
| IUPAC Name | 9-dibenzothiophen-2-yl-3-N-naphthalen-1-yl-9-(2,3,4,5,6-pentadeuteriophenyl)-3-N,6-N,6-N-triphenylfluorene-3,6-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc4sc5ccccc5c4c3)c3ccc(N(c4ccccc4)c4ccccc4)cc3-c3cc(N(c4ccccc4)c4cccc5ccccc45)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C59H40N2S/c1-5-20-42(21-6-1)59(43-32-37-58-53(38-43)50-29-15-16-31-57(50)62-58)54-35-33-47(60(44-22-7-2-8-23-44)45-24-9-3-10-25-45)39-51(54)52-40-48(34-36-55(52)59)61(46-26-11-4-12-27-46)56-30-17-19-41-18-13-14-28-49(41)56/h1-40H/i1D,5D,6D,20D,21D |
| InChIKey | SDUCSTXYHOTHHP-HDJCPTMBSA-N |
| XLogP | 16.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.08 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |