C22H33N3O2 — CID 168791930
butyl 3-[methyl(prop-2-ynyl)amino]-4-(4-phenylpiperazin-1-yl)butanoate (PubChem CID 168791930) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is butyl 3-[methyl(prop-2-ynyl)amino]-4-(4-phenylpiperazin-1-yl)butanoate.
| Compound Name | butyl 3-[methyl(prop-2-ynyl)amino]-4-(4-phenylpiperazin-1-yl)butanoate |
|---|---|
| PubChem CID | 168791930 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | butyl 3-[methyl(prop-2-ynyl)amino]-4-(4-phenylpiperazin-1-yl)butanoate |
| SMILES | C#CCN(C)C(CC(=O)OCCCC)CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-4-6-17-27-22(26)18-21(23(3)12-5-2)19-24-13-15-25(16-14-24)20-10-8-7-9-11-20/h2,7-11,21H,4,6,12-19H2,1,3H3 |
| InChIKey | MRQFWFDHFSVYSU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|