About CID 168792952
CID 168792952 (PubChem CID 168792952) has the molecular formula C3HBr2N3
and a molecular weight of 238.87 g/mol.
Molecular Properties
| Compound Name | CID 168792952 |
| PubChem CID | 168792952 |
| Molecular Formula | C3HBr2N3 |
| Molecular Weight | 238.87 g/mol |
| Exact Mass | 236.85 |
| IUPAC Name | — |
| SMILES | [CH]n1nc(Br)c(Br)n1 |
| InChI | InChI=1S/C3HBr2N3/c1-8-6-2(4)3(5)7-8/h1H |
| InChIKey | OCDYRMAFLVWFHK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.87 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 168792952 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168792952?
The IUPAC name of CID 168792952 (CID 168792952) is not available.
What is the SMILES notation for CID 168792952?
The canonical SMILES for CID 168792952 is [CH]n1nc(Br)c(Br)n1.
What is the InChIKey of CID 168792952?
The InChIKey is OCDYRMAFLVWFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HBr2N3/c1-8-6-2(4)3(5)7-8/h1H.
What are the key properties of CID 168792952?
CID 168792952 has a molecular weight of 238.87 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168792952 is sourced from PubChem (CID 168792952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).