C26H32N8O3 — CID 168793530
[6-[[6-[[(2R)-2-hydroxycyclohexyl]amino]-3-isocyanoimidazo[1,2-b]pyridazin-8-yl]amino]-2-propan-2-yloxy-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 168793530) has the molecular formula C26H32N8O3 and a molecular weight of 504.60 g/mol. Its IUPAC name is [6-[[6-[[(2R)-2-hydroxycyclohexyl]amino]-3-isocyanoimidazo[1,2-b]pyridazin-8-yl]amino]-2-propan-2-yloxy-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-[[6-[[(2R)-2-hydroxycyclohexyl]amino]-3-isocyanoimidazo[1,2-b]pyridazin-8-yl]amino]-2-propan-2-yloxy-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 168793530 |
| Molecular Formula | C26H32N8O3 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [6-[[6-[[(2R)-2-hydroxycyclohexyl]amino]-3-isocyanoimidazo[1,2-b]pyridazin-8-yl]amino]-2-propan-2-yloxy-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | [C-]#[N+]c1cnc2c(Nc3ccc(C(=O)N4CCCC4)c(OC(C)C)n3)cc(NC3CCCC[C@H]3O)nn12 |
| InChI | InChI=1S/C26H32N8O3/c1-16(2)37-25-17(26(36)33-12-6-7-13-33)10-11-21(31-25)30-19-14-22(29-18-8-4-5-9-20(18)35)32-34-23(27-3)15-28-24(19)34/h10-11,14-16,18,20,35H,4-9,12-13H2,1-2H3,(H,29,32)(H,30,31)/t18?,20-/m1/s1 |
| InChIKey | QNEMJOAFYSKLSA-ROPPNANJSA-N |
| XLogP | 4.16 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|