C14H18N2O2S — CID 16879449
N-(3-methylbutyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide (PubChem CID 16879449) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(3-methylbutyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 16879449 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(3-methylbutyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
| SMILES | CC(C)CCNC(=O)Cc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C14H18N2O2S/c1-10(2)5-6-15-14(17)9-11-8-12(18-16-11)13-4-3-7-19-13/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,15,17) |
| InChIKey | XUPIVGIEDWWMMR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |