C9H8F4N3O+ — CID 168796202
5-fluoro-7-methoxy-8-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyrimidin-8-ium (PubChem CID 168796202) has the molecular formula C9H8F4N3O+ and a molecular weight of 250.17 g/mol. Its IUPAC name is 5-fluoro-7-methoxy-8-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyrimidin-8-ium.
| Compound Name | 5-fluoro-7-methoxy-8-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyrimidin-8-ium |
|---|---|
| PubChem CID | 168796202 |
| Molecular Formula | C9H8F4N3O+ |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-fluoro-7-methoxy-8-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyrimidin-8-ium |
| SMILES | COc1c(C(F)(F)F)c(F)n2ccnc2[n+]1C |
| InChI | InChI=1S/C9H8F4N3O/c1-15-7(17-2)5(9(11,12)13)6(10)16-4-3-14-8(15)16/h3-4H,1-2H3/q+1 |
| InChIKey | FUCCGALOFNYGII-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|